C19H22ClN3O3 — CID 175656810
3-chloro-1-[3-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]propan-1-one (PubChem CID 175656810) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-chloro-1-[3-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-chloro-1-[3-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 175656810 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-chloro-1-[3-[3-(3-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]propan-1-one |
| SMILES | COc1cccc(Oc2nccnc2C2CCCN(C(=O)CCCl)C2)c1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-25-15-5-2-6-16(12-15)26-19-18(21-9-10-22-19)14-4-3-11-23(13-14)17(24)7-8-20/h2,5-6,9-10,12,14H,3-4,7-8,11,13H2,1H3 |
| InChIKey | ILGCJAKCJLKXKF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|