C21H27ClN4O2 — CID 175658170
3-chloro-1-[3-[2-(dimethylamino)-5-(3-methoxyphenyl)pyrimidin-4-yl]piperidin-1-yl]propan-1-one (PubChem CID 175658170) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 3-chloro-1-[3-[2-(dimethylamino)-5-(3-methoxyphenyl)pyrimidin-4-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-chloro-1-[3-[2-(dimethylamino)-5-(3-methoxyphenyl)pyrimidin-4-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 175658170 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-chloro-1-[3-[2-(dimethylamino)-5-(3-methoxyphenyl)pyrimidin-4-yl]piperidin-1-yl]propan-1-one |
| SMILES | COc1cccc(-c2cnc(N(C)C)nc2C2CCCN(C(=O)CCCl)C2)c1 |
| InChI | InChI=1S/C21H27ClN4O2/c1-25(2)21-23-13-18(15-6-4-8-17(12-15)28-3)20(24-21)16-7-5-11-26(14-16)19(27)9-10-22/h4,6,8,12-13,16H,5,7,9-11,14H2,1-3H3 |
| InChIKey | QUQDBBKNXQHQEW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|