C26H38N4O3S — CID 45170840
3-(diethylamino)-1-[3-[2-(2-methoxyethylsulfanyl)-5-(3-methoxyphenyl)pyrimidin-4-yl]piperidin-1-yl]propan-1-one (PubChem CID 45170840) has the molecular formula C26H38N4O3S and a molecular weight of 486.68 g/mol. Its IUPAC name is 3-(diethylamino)-1-[3-[2-(2-methoxyethylsulfanyl)-5-(3-methoxyphenyl)pyrimidin-4-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-(diethylamino)-1-[3-[2-(2-methoxyethylsulfanyl)-5-(3-methoxyphenyl)pyrimidin-4-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 45170840 |
| Molecular Formula | C26H38N4O3S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 3-(diethylamino)-1-[3-[2-(2-methoxyethylsulfanyl)-5-(3-methoxyphenyl)pyrimidin-4-yl]piperidin-1-yl]propan-1-one |
| SMILES | CCN(CC)CCC(=O)N1CCCC(c2nc(SCCOC)ncc2-c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C26H38N4O3S/c1-5-29(6-2)14-12-24(31)30-13-8-10-21(19-30)25-23(20-9-7-11-22(17-20)33-4)18-27-26(28-25)34-16-15-32-3/h7,9,11,17-18,21H,5-6,8,10,12-16,19H2,1-4H3 |
| InChIKey | XZTNZOKJOUNICH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|