C21H26ClN5O2 — CID 175656077
3-[4-[1-(3-chloropropanoyl)piperidin-4-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide (PubChem CID 175656077) has the molecular formula C21H26ClN5O2 and a molecular weight of 415.93 g/mol. Its IUPAC name is 3-[4-[1-(3-chloropropanoyl)piperidin-4-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide.
| Compound Name | 3-[4-[1-(3-chloropropanoyl)piperidin-4-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 175656077 |
| Molecular Formula | C21H26ClN5O2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-[4-[1-(3-chloropropanoyl)piperidin-4-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide |
| SMILES | CN(C)c1ncc(-c2cccc(C(N)=O)c2)c(C2CCN(C(=O)CCCl)CC2)n1 |
| InChI | InChI=1S/C21H26ClN5O2/c1-26(2)21-24-13-17(15-4-3-5-16(12-15)20(23)29)19(25-21)14-7-10-27(11-8-14)18(28)6-9-22/h3-5,12-14H,6-11H2,1-2H3,(H2,23,29) |
| InChIKey | TVULYZQLHCZZMD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|