C25H35N5O — CID 92618269
3-[4-[1-(cyclohexylmethyl)piperidin-4-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide (PubChem CID 92618269) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-[4-[1-(cyclohexylmethyl)piperidin-4-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide.
| Compound Name | 3-[4-[1-(cyclohexylmethyl)piperidin-4-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 92618269 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 3-[4-[1-(cyclohexylmethyl)piperidin-4-yl]-2-(dimethylamino)pyrimidin-5-yl]benzamide |
| SMILES | CN(C)c1ncc(-c2cccc(C(N)=O)c2)c(C2CCN(CC3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C25H35N5O/c1-29(2)25-27-16-22(20-9-6-10-21(15-20)24(26)31)23(28-25)19-11-13-30(14-12-19)17-18-7-4-3-5-8-18/h6,9-10,15-16,18-19H,3-5,7-8,11-14,17H2,1-2H3,(H2,26,31) |
| InChIKey | RKPFNIQVYQBPSF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |