C16H17F2N3 — CID 110257421
2-(3,4-difluorophenyl)-5-(piperidin-3-ylmethyl)pyrazine (PubChem CID 110257421) has the molecular formula C16H17F2N3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-(piperidin-3-ylmethyl)pyrazine.
| Compound Name | 2-(3,4-difluorophenyl)-5-(piperidin-3-ylmethyl)pyrazine |
|---|---|
| PubChem CID | 110257421 |
| Molecular Formula | C16H17F2N3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-(piperidin-3-ylmethyl)pyrazine |
| SMILES | Fc1ccc(-c2cnc(CC3CCCNC3)cn2)cc1F |
| InChI | InChI=1S/C16H17F2N3/c17-14-4-3-12(7-15(14)18)16-10-20-13(9-21-16)6-11-2-1-5-19-8-11/h3-4,7,9-11,19H,1-2,5-6,8H2 |
| InChIKey | CHDPHORNTAKRND-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |