C12H14ClF2N — CID 84802944
3-[(4-chloro-2,6-difluorophenyl)methyl]piperidine (PubChem CID 84802944) has the molecular formula C12H14ClF2N and a molecular weight of 245.70 g/mol. Its IUPAC name is 3-[(4-chloro-2,6-difluorophenyl)methyl]piperidine.
| Compound Name | 3-[(4-chloro-2,6-difluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 84802944 |
| Molecular Formula | C12H14ClF2N |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-[(4-chloro-2,6-difluorophenyl)methyl]piperidine |
| SMILES | Fc1cc(Cl)cc(F)c1CC1CCCNC1 |
| InChI | InChI=1S/C12H14ClF2N/c13-9-5-11(14)10(12(15)6-9)4-8-2-1-3-16-7-8/h5-6,8,16H,1-4,7H2 |
| InChIKey | RROFFFXXFZOGTR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |