C12H12F5N — CID 90697244
3-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidine (PubChem CID 90697244) has the molecular formula C12H12F5N and a molecular weight of 265.22 g/mol. Its IUPAC name is 3-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidine.
| Compound Name | 3-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 90697244 |
| Molecular Formula | C12H12F5N |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidine |
| SMILES | Fc1c(F)c(F)c(CC2CCCNC2)c(F)c1F |
| InChI | InChI=1S/C12H12F5N/c13-8-7(4-6-2-1-3-18-5-6)9(14)11(16)12(17)10(8)15/h6,18H,1-5H2 |
| InChIKey | XYDUJJHNSOIJMU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|