C12H14BrF2N — CID 84814784
3-[(2-bromo-3,4-difluorophenyl)methyl]piperidine (PubChem CID 84814784) has the molecular formula C12H14BrF2N and a molecular weight of 290.15 g/mol. Its IUPAC name is 3-[(2-bromo-3,4-difluorophenyl)methyl]piperidine.
| Compound Name | 3-[(2-bromo-3,4-difluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 84814784 |
| Molecular Formula | C12H14BrF2N |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 3-[(2-bromo-3,4-difluorophenyl)methyl]piperidine |
| SMILES | Fc1ccc(CC2CCCNC2)c(Br)c1F |
| InChI | InChI=1S/C12H14BrF2N/c13-11-9(3-4-10(14)12(11)15)6-8-2-1-5-16-7-8/h3-4,8,16H,1-2,5-7H2 |
| InChIKey | NFWPQBSHAHAIHV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|