C12H12ClF4N — CID 117118055
3-[(4-chloro-2,3,5,6-tetrafluorophenyl)methyl]piperidine (PubChem CID 117118055) has the molecular formula C12H12ClF4N and a molecular weight of 281.68 g/mol. Its IUPAC name is 3-[(4-chloro-2,3,5,6-tetrafluorophenyl)methyl]piperidine.
| Compound Name | 3-[(4-chloro-2,3,5,6-tetrafluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 117118055 |
| Molecular Formula | C12H12ClF4N |
| Molecular Weight | 281.68 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-[(4-chloro-2,3,5,6-tetrafluorophenyl)methyl]piperidine |
| SMILES | Fc1c(F)c(CC2CCCNC2)c(F)c(F)c1Cl |
| InChI | InChI=1S/C12H12ClF4N/c13-8-11(16)9(14)7(10(15)12(8)17)4-6-2-1-3-18-5-6/h6,18H,1-5H2 |
| InChIKey | SNASJSJCUICKKX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|