C15H22ClNO — CID 117117999
2-chloro-3,5,6-trimethyl-4-(piperidin-3-ylmethyl)phenol (PubChem CID 117117999) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is 2-chloro-3,5,6-trimethyl-4-(piperidin-3-ylmethyl)phenol.
| Compound Name | 2-chloro-3,5,6-trimethyl-4-(piperidin-3-ylmethyl)phenol |
|---|---|
| PubChem CID | 117117999 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-chloro-3,5,6-trimethyl-4-(piperidin-3-ylmethyl)phenol |
| SMILES | Cc1c(C)c(CC2CCCNC2)c(C)c(Cl)c1O |
| InChI | InChI=1S/C15H22ClNO/c1-9-10(2)15(18)14(16)11(3)13(9)7-12-5-4-6-17-8-12/h12,17-18H,4-8H2,1-3H3 |
| InChIKey | VFKSZVBNJYZUIR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |