C18H26N4O3 — CID 110257660
3-[(1-acetylpiperidin-3-yl)methyl]-N-(oxan-4-yl)pyrazine-2-carboxamide (PubChem CID 110257660) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[(1-acetylpiperidin-3-yl)methyl]-N-(oxan-4-yl)pyrazine-2-carboxamide.
| Compound Name | 3-[(1-acetylpiperidin-3-yl)methyl]-N-(oxan-4-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110257660 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-[(1-acetylpiperidin-3-yl)methyl]-N-(oxan-4-yl)pyrazine-2-carboxamide |
| SMILES | CC(=O)N1CCCC(Cc2nccnc2C(=O)NC2CCOCC2)C1 |
| InChI | InChI=1S/C18H26N4O3/c1-13(23)22-8-2-3-14(12-22)11-16-17(20-7-6-19-16)18(24)21-15-4-9-25-10-5-15/h6-7,14-15H,2-5,8-12H2,1H3,(H,21,24) |
| InChIKey | HOUOWVIOZYMMEN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |