C19H28N4O2 — CID 110271533
3-[(1-acetylpiperidin-3-yl)methyl]-N-cyclohexylpyrazine-2-carboxamide (PubChem CID 110271533) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[(1-acetylpiperidin-3-yl)methyl]-N-cyclohexylpyrazine-2-carboxamide.
| Compound Name | 3-[(1-acetylpiperidin-3-yl)methyl]-N-cyclohexylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110271533 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-[(1-acetylpiperidin-3-yl)methyl]-N-cyclohexylpyrazine-2-carboxamide |
| SMILES | CC(=O)N1CCCC(Cc2nccnc2C(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C19H28N4O2/c1-14(24)23-11-5-6-15(13-23)12-17-18(21-10-9-20-17)19(25)22-16-7-3-2-4-8-16/h9-10,15-16H,2-8,11-13H2,1H3,(H,22,25) |
| InChIKey | XRTLELGYHOPKQL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |