C14H18N6O — CID 110258052
N,N-dimethyl-4-(4-pyrazin-2-ylmorpholin-2-yl)pyrimidin-2-amine (PubChem CID 110258052) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-pyrazin-2-ylmorpholin-2-yl)pyrimidin-2-amine.
| Compound Name | N,N-dimethyl-4-(4-pyrazin-2-ylmorpholin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 110258052 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N,N-dimethyl-4-(4-pyrazin-2-ylmorpholin-2-yl)pyrimidin-2-amine |
| SMILES | CN(C)c1nccc(C2CN(c3cnccn3)CCO2)n1 |
| InChI | InChI=1S/C14H18N6O/c1-19(2)14-17-4-3-11(18-14)12-10-20(7-8-21-12)13-9-15-5-6-16-13/h3-6,9,12H,7-8,10H2,1-2H3 |
| InChIKey | YYEXWWGEGRBZGL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |