C18H29N5O2 — CID 128964972
[2-[2-(dimethylamino)pyrimidin-4-yl]morpholin-4-yl]-(1-ethylpiperidin-2-yl)methanone (PubChem CID 128964972) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is [2-[2-(dimethylamino)pyrimidin-4-yl]morpholin-4-yl]-(1-ethylpiperidin-2-yl)methanone.
| Compound Name | [2-[2-(dimethylamino)pyrimidin-4-yl]morpholin-4-yl]-(1-ethylpiperidin-2-yl)methanone |
|---|---|
| PubChem CID | 128964972 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | [2-[2-(dimethylamino)pyrimidin-4-yl]morpholin-4-yl]-(1-ethylpiperidin-2-yl)methanone |
| SMILES | CCN1CCCCC1C(=O)N1CCOC(c2ccnc(N(C)C)n2)C1 |
| InChI | InChI=1S/C18H29N5O2/c1-4-22-10-6-5-7-15(22)17(24)23-11-12-25-16(13-23)14-8-9-19-18(20-14)21(2)3/h8-9,15-16H,4-7,10-13H2,1-3H3 |
| InChIKey | CAPVXBXTRKNEGB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |