C16H23N7O2 — CID 129341058
(2R)-2-[2-(dimethylamino)pyrimidin-4-yl]-N-(2-pyrazol-1-ylethyl)morpholine-4-carboxamide (PubChem CID 129341058) has the molecular formula C16H23N7O2 and a molecular weight of 345.41 g/mol. Its IUPAC name is (2R)-2-[2-(dimethylamino)pyrimidin-4-yl]-N-(2-pyrazol-1-ylethyl)morpholine-4-carboxamide.
| Compound Name | (2R)-2-[2-(dimethylamino)pyrimidin-4-yl]-N-(2-pyrazol-1-ylethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 129341058 |
| Molecular Formula | C16H23N7O2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (2R)-2-[2-(dimethylamino)pyrimidin-4-yl]-N-(2-pyrazol-1-ylethyl)morpholine-4-carboxamide |
| SMILES | CN(C)c1nccc([C@H]2CN(C(=O)NCCn3cccn3)CCO2)n1 |
| InChI | InChI=1S/C16H23N7O2/c1-21(2)15-17-6-4-13(20-15)14-12-22(10-11-25-14)16(24)18-7-9-23-8-3-5-19-23/h3-6,8,14H,7,9-12H2,1-2H3,(H,18,24)/t14-/m1/s1 |
| InChIKey | YGDNOIOGRWWSAX-CQSZACIVSA-N |
| XLogP | 0.52 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |