C17H22N6O2 — CID 129477542
(2R)-2-[2-(dimethylamino)pyrimidin-4-yl]-N-(4-methyl-2-pyridinyl)morpholine-4-carboxamide (PubChem CID 129477542) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2R)-2-[2-(dimethylamino)pyrimidin-4-yl]-N-(4-methyl-2-pyridinyl)morpholine-4-carboxamide.
| Compound Name | (2R)-2-[2-(dimethylamino)pyrimidin-4-yl]-N-(4-methyl-2-pyridinyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 129477542 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2R)-2-[2-(dimethylamino)pyrimidin-4-yl]-N-(4-methyl-2-pyridinyl)morpholine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)N2CCO[C@@H](c3ccnc(N(C)C)n3)C2)c1 |
| InChI | InChI=1S/C17H22N6O2/c1-12-4-6-18-15(10-12)21-17(24)23-8-9-25-14(11-23)13-5-7-19-16(20-13)22(2)3/h4-7,10,14H,8-9,11H2,1-3H3,(H,18,21,24)/t14-/m1/s1 |
| InChIKey | RIBJEAAMNAGWLH-CQSZACIVSA-N |
| XLogP | 1.85 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |