C15H17F3N2O2 — CID 110258666
1-[4-acetyl-3-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 110258666) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-[4-acetyl-3-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-acetyl-3-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110258666 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-[4-acetyl-3-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(C)=O)C(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H17F3N2O2/c1-10(21)19-7-8-20(11(2)22)14(9-19)12-3-5-13(6-4-12)15(16,17)18/h3-6,14H,7-9H2,1-2H3 |
| InChIKey | RRCBTQQKFIOJST-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |