C23H26N4O3S — CID 110259917
N-(2-methoxyethyl)-3-[[1-(5-methylpyrazine-2-carbonyl)pyrrolidin-2-yl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 110259917) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[[1-(5-methylpyrazine-2-carbonyl)pyrrolidin-2-yl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-[[1-(5-methylpyrazine-2-carbonyl)pyrrolidin-2-yl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110259917 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-(2-methoxyethyl)-3-[[1-(5-methylpyrazine-2-carbonyl)pyrrolidin-2-yl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1sc2ccccc2c1CC1CCCN1C(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C23H26N4O3S/c1-15-13-26-19(14-25-15)23(29)27-10-5-6-16(27)12-18-17-7-3-4-8-20(17)31-21(18)22(28)24-9-11-30-2/h3-4,7-8,13-14,16H,5-6,9-12H2,1-2H3,(H,24,28) |
| InChIKey | CUPHBCLMHUZUDJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|