C21H26N4O2S — CID 95830392
3-[[(2S)-1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide (PubChem CID 95830392) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-[[(2S)-1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[[(2S)-1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 95830392 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-[[(2S)-1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1sc2ccccc2c1C[C@@H]1CCCN1Cc1ncc[nH]1 |
| InChI | InChI=1S/C21H26N4O2S/c1-27-12-10-24-21(26)20-17(16-6-2-3-7-18(16)28-20)13-15-5-4-11-25(15)14-19-22-8-9-23-19/h2-3,6-9,15H,4-5,10-14H2,1H3,(H,22,23)(H,24,26)/t15-/m0/s1 |
| InChIKey | XQFRMTHUORVGOA-HNNXBMFYSA-N |
| XLogP | 3.21 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|