C20H26FN3O3S — CID 110261543
3-(1-cyclopentylsulfonylpyrrolidin-3-yl)-5-[2-(2-fluorophenoxy)ethyl]-1H-pyrazole (PubChem CID 110261543) has the molecular formula C20H26FN3O3S and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-(1-cyclopentylsulfonylpyrrolidin-3-yl)-5-[2-(2-fluorophenoxy)ethyl]-1H-pyrazole.
| Compound Name | 3-(1-cyclopentylsulfonylpyrrolidin-3-yl)-5-[2-(2-fluorophenoxy)ethyl]-1H-pyrazole |
|---|---|
| PubChem CID | 110261543 |
| Molecular Formula | C20H26FN3O3S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 3-(1-cyclopentylsulfonylpyrrolidin-3-yl)-5-[2-(2-fluorophenoxy)ethyl]-1H-pyrazole |
| SMILES | O=S(=O)(C1CCCC1)N1CCC(c2cc(CCOc3ccccc3F)[nH]n2)C1 |
| InChI | InChI=1S/C20H26FN3O3S/c21-18-7-3-4-8-20(18)27-12-10-16-13-19(23-22-16)15-9-11-24(14-15)28(25,26)17-5-1-2-6-17/h3-4,7-8,13,15,17H,1-2,5-6,9-12,14H2,(H,22,23) |
| InChIKey | JHCQQIIEVXVWIK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |