C23H29N5O — CID 110264179
2-cyclopent-2-en-1-yl-1-[4-[5-[(4,6-dimethylpyrimidin-2-yl)amino]-2-pyridinyl]piperidin-1-yl]ethanone (PubChem CID 110264179) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-1-[4-[5-[(4,6-dimethylpyrimidin-2-yl)amino]-2-pyridinyl]piperidin-1-yl]ethanone.
| Compound Name | 2-cyclopent-2-en-1-yl-1-[4-[5-[(4,6-dimethylpyrimidin-2-yl)amino]-2-pyridinyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110264179 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-1-[4-[5-[(4,6-dimethylpyrimidin-2-yl)amino]-2-pyridinyl]piperidin-1-yl]ethanone |
| SMILES | Cc1cc(C)nc(Nc2ccc(C3CCN(C(=O)CC4C=CCC4)CC3)nc2)n1 |
| InChI | InChI=1S/C23H29N5O/c1-16-13-17(2)26-23(25-16)27-20-7-8-21(24-15-20)19-9-11-28(12-10-19)22(29)14-18-5-3-4-6-18/h3,5,7-8,13,15,18-19H,4,6,9-12,14H2,1-2H3,(H,25,26,27) |
| InChIKey | ZNHBHQIVVPOBJG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|