C16H21N3O3 — CID 129469400
1-[1-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]piperidin-4-yl]pyrazole-4-carboxylic acid (PubChem CID 129469400) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[1-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]piperidin-4-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[1-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]piperidin-4-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 129469400 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[1-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]piperidin-4-yl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(C2CCN(C(=O)C[C@@H]3C=CCC3)CC2)c1 |
| InChI | InChI=1S/C16H21N3O3/c20-15(9-12-3-1-2-4-12)18-7-5-14(6-8-18)19-11-13(10-17-19)16(21)22/h1,3,10-12,14H,2,4-9H2,(H,21,22)/t12-/m1/s1 |
| InChIKey | HXTYAQHBIMTEBA-GFCCVEGCSA-N |
| XLogP | 2.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|