C16H21N3O3 — CID 95882974
1-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-pyrazol-1-ylpiperidine-4-carboxylic acid (PubChem CID 95882974) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-pyrazol-1-ylpiperidine-4-carboxylic acid.
| Compound Name | 1-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-pyrazol-1-ylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 95882974 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-pyrazol-1-ylpiperidine-4-carboxylic acid |
| SMILES | O=C(C[C@@H]1C=CCC1)N1CCC(C(=O)O)(n2cccn2)CC1 |
| InChI | InChI=1S/C16H21N3O3/c20-14(12-13-4-1-2-5-13)18-10-6-16(7-11-18,15(21)22)19-9-3-8-17-19/h1,3-4,8-9,13H,2,5-7,10-12H2,(H,21,22)/t13-/m1/s1 |
| InChIKey | OXZRVGSDCLNURI-CYBMUJFWSA-N |
| XLogP | 1.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|