C18H21N3O4 — CID 56890003
1-(2-phenylmethoxyacetyl)-4-pyrazol-1-ylpiperidine-4-carboxylic acid (PubChem CID 56890003) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-(2-phenylmethoxyacetyl)-4-pyrazol-1-ylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2-phenylmethoxyacetyl)-4-pyrazol-1-ylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56890003 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-(2-phenylmethoxyacetyl)-4-pyrazol-1-ylpiperidine-4-carboxylic acid |
| SMILES | O=C(COCc1ccccc1)N1CCC(C(=O)O)(n2cccn2)CC1 |
| InChI | InChI=1S/C18H21N3O4/c22-16(14-25-13-15-5-2-1-3-6-15)20-11-7-18(8-12-20,17(23)24)21-10-4-9-19-21/h1-6,9-10H,7-8,11-14H2,(H,23,24) |
| InChIKey | QFJJBSHZRZMXGA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |