C24H28FN3O3 — CID 110264227
2-(2-fluorophenoxy)-1-[3-[5-(piperidine-1-carbonyl)-2-pyridinyl]piperidin-1-yl]ethanone (PubChem CID 110264227) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-1-[3-[5-(piperidine-1-carbonyl)-2-pyridinyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(2-fluorophenoxy)-1-[3-[5-(piperidine-1-carbonyl)-2-pyridinyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110264227 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-(2-fluorophenoxy)-1-[3-[5-(piperidine-1-carbonyl)-2-pyridinyl]piperidin-1-yl]ethanone |
| SMILES | O=C(COc1ccccc1F)N1CCCC(c2ccc(C(=O)N3CCCCC3)cn2)C1 |
| InChI | InChI=1S/C24H28FN3O3/c25-20-8-2-3-9-22(20)31-17-23(29)28-14-6-7-19(16-28)21-11-10-18(15-26-21)24(30)27-12-4-1-5-13-27/h2-3,8-11,15,19H,1,4-7,12-14,16-17H2 |
| InChIKey | UIUJZKZGQMASCW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |