C21H22N4O — CID 110267731
1-[3-(6-imidazol-1-yl-2-pyridinyl)piperidin-1-yl]-2-phenylethanone (PubChem CID 110267731) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[3-(6-imidazol-1-yl-2-pyridinyl)piperidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[3-(6-imidazol-1-yl-2-pyridinyl)piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 110267731 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[3-(6-imidazol-1-yl-2-pyridinyl)piperidin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCC(c2cccc(-n3ccnc3)n2)C1 |
| InChI | InChI=1S/C21H22N4O/c26-21(14-17-6-2-1-3-7-17)24-12-5-8-18(15-24)19-9-4-10-20(23-19)25-13-11-22-16-25/h1-4,6-7,9-11,13,16,18H,5,8,12,14-15H2 |
| InChIKey | MKRJNOYVZJTYRJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |