C19H20N6O — CID 95815681
1-[(3S)-3-(6-imidazol-1-ylpyrazin-2-yl)piperidin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 95815681) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[(3S)-3-(6-imidazol-1-ylpyrazin-2-yl)piperidin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(3S)-3-(6-imidazol-1-ylpyrazin-2-yl)piperidin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 95815681 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-[(3S)-3-(6-imidazol-1-ylpyrazin-2-yl)piperidin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CCC[C@H](c2cncc(-n3ccnc3)n2)C1 |
| InChI | InChI=1S/C19H20N6O/c26-19(9-15-3-1-5-20-10-15)24-7-2-4-16(13-24)17-11-22-12-18(23-17)25-8-6-21-14-25/h1,3,5-6,8,10-12,14,16H,2,4,7,9,13H2/t16-/m0/s1 |
| InChIKey | CFDCYASTFHZIAA-INIZCTEOSA-N |
| XLogP | 2.01 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |