C16H17N7 — CID 95815844
2-imidazol-1-yl-6-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]pyrazine (PubChem CID 95815844) has the molecular formula C16H17N7 and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-imidazol-1-yl-6-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]pyrazine.
| Compound Name | 2-imidazol-1-yl-6-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]pyrazine |
|---|---|
| PubChem CID | 95815844 |
| Molecular Formula | C16H17N7 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-imidazol-1-yl-6-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]pyrazine |
| SMILES | c1cnc(N2CCC[C@H](c3cncc(-n4ccnc4)n3)C2)nc1 |
| InChI | InChI=1S/C16H17N7/c1-3-13(11-22(7-1)16-19-4-2-5-20-16)14-9-18-10-15(21-14)23-8-6-17-12-23/h2,4-6,8-10,12-13H,1,3,7,11H2/t13-/m0/s1 |
| InChIKey | UGQDSLIZWFTABZ-ZDUSSCGKSA-N |
| XLogP | 1.84 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |