C16H24N4O4 — CID 110268377
[4-[(2-methoxypyrimidin-5-yl)methyl]-2-methylmorpholin-2-yl]-morpholin-4-ylmethanone (PubChem CID 110268377) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is [4-[(2-methoxypyrimidin-5-yl)methyl]-2-methylmorpholin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(2-methoxypyrimidin-5-yl)methyl]-2-methylmorpholin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 110268377 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [4-[(2-methoxypyrimidin-5-yl)methyl]-2-methylmorpholin-2-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ncc(CN2CCOC(C)(C(=O)N3CCOCC3)C2)cn1 |
| InChI | InChI=1S/C16H24N4O4/c1-16(14(21)20-4-6-23-7-5-20)12-19(3-8-24-16)11-13-9-17-15(22-2)18-10-13/h9-10H,3-8,11-12H2,1-2H3 |
| InChIKey | ARZRISUQWDWAQO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |