C14H18F3N5O2 — CID 171492951
morpholin-2-yl-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 171492951) has the molecular formula C14H18F3N5O2 and a molecular weight of 345.33 g/mol. Its IUPAC name is morpholin-2-yl-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | morpholin-2-yl-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171492951 |
| Molecular Formula | C14H18F3N5O2 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | morpholin-2-yl-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | O=C(C1CNCCO1)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C14H18F3N5O2/c15-14(16,17)10-7-19-13(20-8-10)22-4-2-21(3-5-22)12(23)11-9-18-1-6-24-11/h7-8,11,18H,1-6,9H2 |
| InChIKey | HRAHGTNLZHGYLY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |