C20H19N5O — CID 110268573
pyridin-3-yl-[3-(5-pyrimidin-5-yl-2-pyridinyl)piperidin-1-yl]methanone (PubChem CID 110268573) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is pyridin-3-yl-[3-(5-pyrimidin-5-yl-2-pyridinyl)piperidin-1-yl]methanone.
| Compound Name | pyridin-3-yl-[3-(5-pyrimidin-5-yl-2-pyridinyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110268573 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | pyridin-3-yl-[3-(5-pyrimidin-5-yl-2-pyridinyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccnc1)N1CCCC(c2ccc(-c3cncnc3)cn2)C1 |
| InChI | InChI=1S/C20H19N5O/c26-20(16-3-1-7-21-9-16)25-8-2-4-17(13-25)19-6-5-15(12-24-19)18-10-22-14-23-11-18/h1,3,5-7,9-12,14,17H,2,4,8,13H2 |
| InChIKey | PNLNKYOKGZZLOO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |