C12H13N5 — CID 110269258
2-(1-pyrazin-2-ylpyrrolidin-2-yl)pyrazine (PubChem CID 110269258) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-(1-pyrazin-2-ylpyrrolidin-2-yl)pyrazine.
| Compound Name | 2-(1-pyrazin-2-ylpyrrolidin-2-yl)pyrazine |
|---|---|
| PubChem CID | 110269258 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-(1-pyrazin-2-ylpyrrolidin-2-yl)pyrazine |
| SMILES | c1cnc(C2CCCN2c2cnccn2)cn1 |
| InChI | InChI=1S/C12H13N5/c1-2-11(10-8-13-3-5-15-10)17(7-1)12-9-14-4-6-16-12/h3-6,8-9,11H,1-2,7H2 |
| InChIKey | AVPJLMTYAJIKJH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |