C16H16N8 — CID 127244984
N-pyrazin-2-yl-3-(1-pyrazin-2-ylpyrrolidin-2-yl)pyrazin-2-amine (PubChem CID 127244984) has the molecular formula C16H16N8 and a molecular weight of 320.36 g/mol. Its IUPAC name is N-pyrazin-2-yl-3-(1-pyrazin-2-ylpyrrolidin-2-yl)pyrazin-2-amine.
| Compound Name | N-pyrazin-2-yl-3-(1-pyrazin-2-ylpyrrolidin-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 127244984 |
| Molecular Formula | C16H16N8 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-pyrazin-2-yl-3-(1-pyrazin-2-ylpyrrolidin-2-yl)pyrazin-2-amine |
| SMILES | c1cnc(Nc2nccnc2C2CCCN2c2cnccn2)cn1 |
| InChI | InChI=1S/C16H16N8/c1-2-12(24(9-1)14-11-18-4-6-20-14)15-16(22-8-7-21-15)23-13-10-17-3-5-19-13/h3-8,10-12H,1-2,9H2,(H,19,22,23) |
| InChIKey | IZYUWAXVWCSCEB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |