C21H39NO8Si — CID 11026943
tert-butyl (2R,3S,4S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3,4-dihydroxy-5-oxopyrrolidine-1-carboxylate (PubChem CID 11026943) has the molecular formula C21H39NO8Si and a molecular weight of 461.63 g/mol. Its IUPAC name is tert-butyl (2R,3S,4S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3,4-dihydroxy-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3,4-dihydroxy-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11026943 |
| Molecular Formula | C21H39NO8Si |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | tert-butyl (2R,3S,4S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3,4-dihydroxy-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H](O)[C@@H](O)[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H39NO8Si/c1-19(2,3)29-18(26)22-13(14(23)15(24)17(22)25)16(12-11-27-21(7,8)28-12)30-31(9,10)20(4,5)6/h12-16,23-24H,11H2,1-10H3/t12-,13-,14+,15+,16-/m1/s1 |
| InChIKey | DJWBYGJWTSTOGH-RBGFHDKUSA-N |
| XLogP | 2.40 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|