C24H43NO9Si — CID 11526434
tert-butyl (3R,5S)-3-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-5-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 11526434) has the molecular formula C24H43NO9Si and a molecular weight of 517.69 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-5-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-3-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-5-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11526434 |
| Molecular Formula | C24H43NO9Si |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | tert-butyl (3R,5S)-3-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-5-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H]([C@H](O)[C@@H]2COC(C)(C)O2)C[C@H]1[C@@H](O[Si](C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H43NO9Si/c1-22(2,3)33-21(28)25-15(19(34-35(8,9)10)17-13-30-24(6,7)32-17)11-14(20(25)27)18(26)16-12-29-23(4,5)31-16/h14-19,26H,11-13H2,1-10H3/t14-,15+,16+,17+,18+,19-/m1/s1 |
| InChIKey | BWOFBPRVDPXWOB-YLXRRXKZSA-N |
| XLogP | 3.02 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|