C30H57NO8Si2 — CID 11512831
(3R,5S)-1-acetyl-3,5-bis[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one (PubChem CID 11512831) has the molecular formula C30H57NO8Si2 and a molecular weight of 615.96 g/mol. Its IUPAC name is (3R,5S)-1-acetyl-3,5-bis[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one.
| Compound Name | (3R,5S)-1-acetyl-3,5-bis[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11512831 |
| Molecular Formula | C30H57NO8Si2 |
| Molecular Weight | 615.96 g/mol |
| Exact Mass | 615.36 |
| IUPAC Name | (3R,5S)-1-acetyl-3,5-bis[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one |
| SMILES | CC(=O)N1C(=O)[C@@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2COC(C)(C)O2)C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C30H57NO8Si2/c1-19(32)31-21(25(23-18-35-30(10,11)37-23)39-41(14,15)28(5,6)7)16-20(26(31)33)24(22-17-34-29(8,9)36-22)38-40(12,13)27(2,3)4/h20-25H,16-18H2,1-15H3/t20-,21+,22+,23+,24-,25-/m1/s1 |
| InChIKey | VDTVIEYKCULYMC-QPKNRHBWSA-N |
| XLogP | 5.83 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.96 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|