C29H43F3O — CID 11026997
(2E,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2-(2,2,2-trifluoroethylidene)-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 11026997) has the molecular formula C29H43F3O and a molecular weight of 464.66 g/mol. Its IUPAC name is (2E,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2-(2,2,2-trifluoroethylidene)-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (2E,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2-(2,2,2-trifluoroethylidene)-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 11026997 |
| Molecular Formula | C29H43F3O |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | (2E,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2-(2,2,2-trifluoroethylidene)-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)/C(=C/C(F)(F)F)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H43F3O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-21-15-26(33)20(17-29(30,31)32)16-28(21,5)25(22)13-14-27(23,24)4/h15,17-19,22-25H,6-14,16H2,1-5H3/b20-17+/t19-,22+,23-,24+,25+,27-,28+/m1/s1 |
| InChIKey | FFYBPCJSOUTHRF-VSNVJAOYSA-N |
| XLogP | 8.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|