C30H48O2 — CID 15435550
(2Z,8S,9S,10R,13R,14S,17R)-2-(ethoxymethylidene)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 15435550) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (2Z,8S,9S,10R,13R,14S,17R)-2-(ethoxymethylidene)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (2Z,8S,9S,10R,13R,14S,17R)-2-(ethoxymethylidene)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 15435550 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (2Z,8S,9S,10R,13R,14S,17R)-2-(ethoxymethylidene)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCO/C=C1/C[C@@]2(C)C(=CC1=O)CC[C@H]1[C@@H]3CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H48O2/c1-7-32-19-22-18-30(6)23(17-28(22)31)11-12-24-26-14-13-25(21(4)10-8-9-20(2)3)29(26,5)16-15-27(24)30/h17,19-21,24-27H,7-16,18H2,1-6H3/b22-19-/t21-,24+,25-,26+,27+,29-,30+/m1/s1 |
| InChIKey | IKIWXPRUYYBHOY-ZGSRDPLMSA-N |
| XLogP | 8.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|