About 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine
2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine (PubChem CID 110270220) has the molecular formula C20H22FN5O
and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine.
Molecular Properties
| Compound Name | 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine |
| PubChem CID | 110270220 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine |
| SMILES | Cc1nn(C)cc1CN1CCCC1c1cncc(Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H22FN5O/c1-14-15(12-25(2)24-14)13-26-9-3-4-19(26)18-10-22-11-20(23-18)27-17-7-5-16(21)6-8-17/h5-8,10-12,19H,3-4,9,13H2,1-2H3 |
| InChIKey | YDYPOBABOKEVJU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine?
The IUPAC name of 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine (CID 110270220) is 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine.
What is the SMILES notation for 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine?
The canonical SMILES for 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine is Cc1nn(C)cc1CN1CCCC1c1cncc(Oc2ccc(F)cc2)n1.
What is the InChIKey of 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine?
The InChIKey is YDYPOBABOKEVJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FN5O/c1-14-15(12-25(2)24-14)13-26-9-3-4-19(26)18-10-22-11-20(23-18)27-17-7-5-16(21)6-8-17/h5-8,10-12,19H,3-4,9,13H2,1-2H3.
What are the key properties of 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine?
2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine has a molecular weight of 367.43 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-6-(4-fluorophenoxy)pyrazine is sourced from PubChem (CID 110270220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).