C18H24ClN3 — CID 92878029
(2S)-2-(4-chlorophenyl)-1-[(1,3-dimethylpyrazol-4-yl)methyl]azepane (PubChem CID 92878029) has the molecular formula C18H24ClN3 and a molecular weight of 317.86 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-1-[(1,3-dimethylpyrazol-4-yl)methyl]azepane.
| Compound Name | (2S)-2-(4-chlorophenyl)-1-[(1,3-dimethylpyrazol-4-yl)methyl]azepane |
|---|---|
| PubChem CID | 92878029 |
| Molecular Formula | C18H24ClN3 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-1-[(1,3-dimethylpyrazol-4-yl)methyl]azepane |
| SMILES | Cc1nn(C)cc1CN1CCCCC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN3/c1-14-16(12-21(2)20-14)13-22-11-5-3-4-6-18(22)15-7-9-17(19)10-8-15/h7-10,12,18H,3-6,11,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | KZGCNJNHFOQXBK-SFHVURJKSA-N |
| XLogP | 4.50 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |