About (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane
(2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane (PubChem CID 92878035) has the molecular formula C17H25N3S
and a molecular weight of 303.48 g/mol. Its IUPAC name is (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane.
Molecular Properties
| Compound Name | (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane |
| PubChem CID | 92878035 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane |
| SMILES | Cc1ccc([C@H]2CCCCCN2Cc2cn(C)nc2C)s1 |
| InChI | InChI=1S/C17H25N3S/c1-13-8-9-17(21-13)16-7-5-4-6-10-20(16)12-15-11-19(3)18-14(15)2/h8-9,11,16H,4-7,10,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | JNIIEZDQAFYMEV-MRXNPFEDSA-N |
| XLogP | 4.22 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane?
The IUPAC name of (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane (CID 92878035) is (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane.
What is the SMILES notation for (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane?
The canonical SMILES for (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane is Cc1ccc([C@H]2CCCCCN2Cc2cn(C)nc2C)s1.
What is the InChIKey of (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane?
The InChIKey is JNIIEZDQAFYMEV-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H25N3S/c1-13-8-9-17(21-13)16-7-5-4-6-10-20(16)12-15-11-19(3)18-14(15)2/h8-9,11,16H,4-7,10,12H2,1-3H3/t16-/m1/s1.
What are the key properties of (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane?
(2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane has a molecular weight of 303.48 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-(5-methylthiophen-2-yl)azepane is sourced from PubChem (CID 92878035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).