C18H23N5O — CID 110271600
2-[3-[(6-anilinopyridazin-3-yl)methyl]piperidin-1-yl]acetamide (PubChem CID 110271600) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-[3-[(6-anilinopyridazin-3-yl)methyl]piperidin-1-yl]acetamide.
| Compound Name | 2-[3-[(6-anilinopyridazin-3-yl)methyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 110271600 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-[3-[(6-anilinopyridazin-3-yl)methyl]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCC(Cc2ccc(Nc3ccccc3)nn2)C1 |
| InChI | InChI=1S/C18H23N5O/c19-17(24)13-23-10-4-5-14(12-23)11-16-8-9-18(22-21-16)20-15-6-2-1-3-7-15/h1-3,6-9,14H,4-5,10-13H2,(H2,19,24)(H,20,22) |
| InChIKey | SYMMDRZVPVNHRI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |