C20H30N6O2 — CID 118747416
N-cyclopentyl-6-[[1-(1H-imidazol-5-ylmethyl)piperidin-3-yl]methyl]pyridazin-3-amine;formic acid (PubChem CID 118747416) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-cyclopentyl-6-[[1-(1H-imidazol-5-ylmethyl)piperidin-3-yl]methyl]pyridazin-3-amine;formic acid.
| Compound Name | N-cyclopentyl-6-[[1-(1H-imidazol-5-ylmethyl)piperidin-3-yl]methyl]pyridazin-3-amine;formic acid |
|---|---|
| PubChem CID | 118747416 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-cyclopentyl-6-[[1-(1H-imidazol-5-ylmethyl)piperidin-3-yl]methyl]pyridazin-3-amine;formic acid |
| SMILES | O=CO.c1ncc(CN2CCCC(Cc3ccc(NC4CCCC4)nn3)C2)[nH]1 |
| InChI | InChI=1S/C19H28N6.CH2O2/c1-2-6-16(5-1)22-19-8-7-17(23-24-19)10-15-4-3-9-25(12-15)13-18-11-20-14-21-18;2-1-3/h7-8,11,14-16H,1-6,9-10,12-13H2,(H,20,21)(H,22,24);1H,(H,2,3) |
| InChIKey | GMGQJHGHYNDYQS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|