C19H23N5O — CID 110271900
6-[4-(1H-indol-5-ylmethyl)morpholin-2-yl]-N,2-dimethylpyrimidin-4-amine (PubChem CID 110271900) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 6-[4-(1H-indol-5-ylmethyl)morpholin-2-yl]-N,2-dimethylpyrimidin-4-amine.
| Compound Name | 6-[4-(1H-indol-5-ylmethyl)morpholin-2-yl]-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 110271900 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 6-[4-(1H-indol-5-ylmethyl)morpholin-2-yl]-N,2-dimethylpyrimidin-4-amine |
| SMILES | CNc1cc(C2CN(Cc3ccc4[nH]ccc4c3)CCO2)nc(C)n1 |
| InChI | InChI=1S/C19H23N5O/c1-13-22-17(10-19(20-2)23-13)18-12-24(7-8-25-18)11-14-3-4-16-15(9-14)5-6-21-16/h3-6,9-10,18,21H,7-8,11-12H2,1-2H3,(H,20,22,23) |
| InChIKey | FSSXFGXEBFRINZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |