C18H29N3O — CID 110272080
4-cycloheptyl-6-[(5-methylpyrazin-2-yl)methyl]-1,4-oxazepane (PubChem CID 110272080) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-cycloheptyl-6-[(5-methylpyrazin-2-yl)methyl]-1,4-oxazepane.
| Compound Name | 4-cycloheptyl-6-[(5-methylpyrazin-2-yl)methyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 110272080 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 4-cycloheptyl-6-[(5-methylpyrazin-2-yl)methyl]-1,4-oxazepane |
| SMILES | Cc1cnc(CC2COCCN(C3CCCCCC3)C2)cn1 |
| InChI | InChI=1S/C18H29N3O/c1-15-11-20-17(12-19-15)10-16-13-21(8-9-22-14-16)18-6-4-2-3-5-7-18/h11-12,16,18H,2-10,13-14H2,1H3 |
| InChIKey | OEIAJDXWVKOBTC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |