C18H14N2O2 — CID 110273804
3-hydroxy-6,7-dimethyl-2-phenylpyrrolo[1,2-a]benzimidazol-1-one (PubChem CID 110273804) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-hydroxy-6,7-dimethyl-2-phenylpyrrolo[1,2-a]benzimidazol-1-one.
| Compound Name | 3-hydroxy-6,7-dimethyl-2-phenylpyrrolo[1,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 110273804 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-hydroxy-6,7-dimethyl-2-phenylpyrrolo[1,2-a]benzimidazol-1-one |
| SMILES | Cc1cc2nc3n(c2cc1C)C(=O)C(c1ccccc1)=C3O |
| InChI | InChI=1S/C18H14N2O2/c1-10-8-13-14(9-11(10)2)20-17(19-13)16(21)15(18(20)22)12-6-4-3-5-7-12/h3-9,21H,1-2H3 |
| InChIKey | MHNKDDVFWDZWNM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |