About [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate
[3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate (PubChem CID 110274429) has the molecular formula C25H19ClO6
and a molecular weight of 450.87 g/mol. Its IUPAC name is [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate.
Molecular Properties
| Compound Name | [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate |
| PubChem CID | 110274429 |
| Molecular Formula | C25H19ClO6 |
| Molecular Weight | 450.87 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate |
| SMILES | COc1cccc(Oc2c(C)oc3cc(OC(=O)C(Cl)c4ccccc4)ccc3c2=O)c1 |
| InChI | InChI=1S/C25H19ClO6/c1-15-24(31-18-10-6-9-17(13-18)29-2)23(27)20-12-11-19(14-21(20)30-15)32-25(28)22(26)16-7-4-3-5-8-16/h3-14,22H,1-2H3 |
| InChIKey | ZYVUXJPNDYOTIP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.87 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate?
The IUPAC name of [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate (CID 110274429) is [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate.
What is the SMILES notation for [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate?
The canonical SMILES for [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate is COc1cccc(Oc2c(C)oc3cc(OC(=O)C(Cl)c4ccccc4)ccc3c2=O)c1.
What is the InChIKey of [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate?
The InChIKey is ZYVUXJPNDYOTIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19ClO6/c1-15-24(31-18-10-6-9-17(13-18)29-2)23(27)20-12-11-19(14-21(20)30-15)32-25(28)22(26)16-7-4-3-5-8-16/h3-14,22H,1-2H3.
What are the key properties of [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate?
[3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate has a molecular weight of 450.87 g/mol, XLogP of 5.79, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl] 2-chloro-2-phenylacetate is sourced from PubChem (CID 110274429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).