C20H17O7- — CID 6972935
(2S)-2-[3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl]oxypropanoate (PubChem CID 6972935) has the molecular formula C20H17O7- and a molecular weight of 369.35 g/mol. Its IUPAC name is (2S)-2-[3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl]oxypropanoate.
| Compound Name | (2S)-2-[3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl]oxypropanoate |
|---|---|
| PubChem CID | 6972935 |
| Molecular Formula | C20H17O7- |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (2S)-2-[3-(3-methoxyphenoxy)-2-methyl-4-oxochromen-7-yl]oxypropanoate |
| SMILES | COc1cccc(Oc2c(C)oc3cc(O[C@@H](C)C(=O)[O-])ccc3c2=O)c1 |
| InChI | InChI=1S/C20H18O7/c1-11-19(27-14-6-4-5-13(9-14)24-3)18(21)16-8-7-15(10-17(16)26-11)25-12(2)20(22)23/h4-10,12H,1-3H3,(H,22,23)/p-1/t12-/m0/s1 |
| InChIKey | HLUORTAUZUVICU-LBPRGKRZSA-M |
| XLogP | 2.42 |
| TPSA | 98.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |