C26H29NO7 — CID 110275839
ethyl 1-[[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl]piperidine-3-carboxylate (PubChem CID 110275839) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is ethyl 1-[[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110275839 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | ethyl 1-[[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2c(O)ccc3c2O/C(=C\c2ccc(OC)c(OC)c2)C3=O)C1 |
| InChI | InChI=1S/C26H29NO7/c1-4-33-26(30)17-6-5-11-27(14-17)15-19-20(28)9-8-18-24(29)23(34-25(18)19)13-16-7-10-21(31-2)22(12-16)32-3/h7-10,12-13,17,28H,4-6,11,14-15H2,1-3H3/b23-13- |
| InChIKey | FUYPUJVJNVSCAC-QRVIBDJDSA-N |
| XLogP | 3.80 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|